Linalyl acetate
ALDRICH/W263605 - ≥97%, FCC, FG
Synonym: 3,7-
CAS Number: 115-95-7
Empirical Formula (Hill Notation): C12H20O2
Molecular Weight: 196.29
EC Number: 204-116-4
MDL Number: MFCD00008907
Linear Formula: CH3CO2C(CH=CH2)(CH3)CH2CH2CH=C(CH3)2
Product Type: Chemical
| agency | meets purity specifications of JECFA |
| application(s) | flavors and fragrances |
| assay | ≥97% |
| biological source | synthetic |
| bp | 220 °C (lit.) |
| density | 0.901 g/mL at 25 °C (lit.) |
| description | synthetic |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Kosher | |
| InChI | 1S/C12H20O2/c1-6-12(5,14- |
| InChI key | UWKAYLJWKGQEPM-UHFFFAOYSA |
| organoleptic | green; woody; floral; sweet |
| Quality Level | 400  |
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FCC | |
| FDA 21 CFR 117 | |
| FDA 21 CFR 182.60 | |
| SMILES string | CC(C)=CCCC(C)(OC(C)=O)C |
| vapor density | 6.8 (vs air) |
| vapor pressure | 0.1 mmHg ( 20 °C) |
| General description: | Linalyl acetate is the main component of many plant essential oils such as lavender oil. It can be used as a flavoring agent and fragrance ingredient. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 9, 20 kg in composite drum |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H317 - H319 |
| Precautionary statements | P261 - P264 - P272 - P280 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | WGK 1 |
| Flash Point(F) | 201.2 °F - closed cup |
| Flash Point(C) | 94 °C - closed cup |
| Purity | ≥97% |
| bp | 220 °C (lit.) |
| Density | 0.901 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2636 |
| UNSPSC | 12164502 |