Synonym: 3,7-dimethyl-1,6-octadien-3-yl butyrate; 3,7-dimethylocta-1,6-dien-3-yl butanoate; Butyric acid linalyl ester; Linalool butyrate; Linalyl 3-methylpropionate
CAS Number: 78-36-4
Empirical Formula (Hill Notation): C14H24O2
Molecular Weight: 224.34
EC Number: 201-109-8
MDL Number: MFCD00048716
Linear Formula: CH3CH2CH2CO2C(CH=CH2)(CH3)CH2CH2CH=C(CH3)2
Product Type: Chemical
| agency |
follows IFRA guidelines |
| |
meets purity specifications of JECFA |
| application(s) |
flavors and fragrances |
| assay |
≥95% |
| biological source |
synthetic |
| bp |
80-82 °C/0.2 mmHg (lit.) |
| density |
0.892 g/mL at 25 °C (lit.) |
| documentation |
see Safety & Documentation for available documents |
| food allergen |
no known allergens |
| fragrance allergen |
no known allergens |
| grade |
FG |
| |
Fragrance grade |
| |
Halal |
| |
Kosher |
| InChI |
1S/C14H24O2/c1-6-9-13(15)16-14(5,7-2)11-8-10-12(3)4/h7,10H,2,6,8-9,11H2,1,3-5H3 |
| InChI key |
FHLGUOHLUFIAAA-UHFFFAOYSA-N |
| organoleptic |
berry; fruity; floral; sweet |
| Quality Level |
300  |
| |
400 |
| refractive index |
n20/D 1.45 (lit.) |
| reg. compliance |
EU Regulation 1223/2009 |
| |
EU Regulation 1334/2008 & 178/2002 |
| |
FDA 21 CFR 117 |
| |
FDA 21 CFR 172.515 |
| SMILES string |
CCCC(=O)OC(C)(CCC=C(C)C)C=C |
| Packaging: |
1 kg in aluminum bottle |
| Packaging: |
250 g in poly bottle |
| Packaging: |
4 kg in poly drum |
| Symbol |
 GHS09 |
| Hazard statements |
H411 |
| Precautionary statements |
P273 - P391 - P501 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
217.4 °F - closed cup |
| Flash Point(C) |
103.00 °C - closed cup |
| Purity |
≥95% |
| bp |
80-82 °C/0.2 mmHg (lit.) |
| Density |
0.892 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.45 (lit.) |
| FEMA Number |
2639 |
| UNSPSC |
12164502 |
