L-Menthone
ALDRICH/W266701 - mixture of isomers, ≥96%, FCC, FG
Synonym: (−)-Menthone; trans-menthone; (1R,4S)-p-Menthan-3-one; (2S,5R)
CAS Number: 14073-97-3
Empirical Formula (Hill Notation): C10H18O
Molecular Weight: 154.25
EC Number: 237-926-1
MDL Number: MFCD00001634
Linear Formula: C10H18O
Product Type: Chemical
| application(s) | flavors and fragrances |
| assay | ≥96% |
| biological source | synthetic |
| bp | 207-210 °C (lit.) |
| density | 0.893 g/mL at 20 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/C10H18O/c1-7(2)9-5-4-8 |
| InChI key | NFLGAXVYCFJBMK-BDAKNGLRSA |
| organoleptic | minty; woody |
| Quality Level | 300  |
| 400 |
|
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FCC | |
| FDA 21 CFR 117 | |
| FDA 21 CFR 172.515 | |
| SMILES string | CC(C)[C@@H]1CC[C@@H](C)CC |
| vapor pressure | 0.5 mmHg ( 20 °C) |
| Biochem/physiol Actions: | Taste at 50 ppm |
| Other Notes: | Natural occurrence: Mentha species. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 9, 20 kg in poly drum |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H317 |
| Precautionary statements | P280 - P302 + P352 |
| Hazard Codes | Xi |
| Risk Statements | 38-43 |
| Safety Statements | 36/37 |
| WGK Germany | WGK 1 |
| Flash Point(F) | 165.2 °F |
| Flash Point(C) | 74 °C |
| Purity | ≥96% |
| bp | 207-210 °C (lit.) |
| Density | 0.893 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2667 |
| UNSPSC | 12164502 |