Neryl acetate
ALDRICH/W277304 - ≥98%, stabilized, FCC, FG
Synonym: cis-
CAS Number: 141-12-8
Empirical Formula (Hill Notation): C12H20O2
Molecular Weight: 196.29
EC Number: 205-459-2
MDL Number: MFCD00063205
Linear Formula: CH3CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2
Product Type: Chemical
| agency | follows IFRA guidelines |
| meets purity specifications of JECFA | |
| application(s) | flavors and fragrances |
| assay | ≥98% |
| biological source | synthetic |
| bp | 134 °C/25 mmHg (lit.) |
| composition | Contains IFRA and EU1223/2009 restricted Citral (Neral + Geranial) and Geraniol |
| density | 0.91 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | geraniol, nerol, citral (neral+geranial) |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| InChI | 1S/C12H20O2/c1-10(2)6-5-7 |
| InChI key | HIGQPQRQIQDZMP-FLIBITNWSA |
| may contain | <0.10% alpha-tocopherol, synthetic as stabilizer |
| organoleptic | citrus; floral; fruity; rose; soapy; sweet |
| Quality Level | 300  |
| 400 |
|
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| FCC | |
| FDA 21 CFR 172.515 | |
| SMILES string | CC(=O)OCC=C(C)CCC=C(/C |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | Taste at 5 ppm |
| Other Notes: | Natural occurrence: Orange juice, lemon, grapefruit, mandarin, lime and bergmot essential oils, black currant buds, grape, nutmeg, cocoa, tea, spice and buchu oil. |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 4, 9 kg in composite drum |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 210.2 °F - closed cup |
| Flash Point(C) | 99 °C - closed cup |
| Purity | ≥98% |
| bp | 134 °C/25 mmHg (lit.) |
| Density | 0.91 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| FEMA Number | 2773 |
| UNSPSC | 12164502 |