Synonym: (E,Z)-2,6-nonadien-1-ol; (E,Z)-cucumber alcohol; (E,Z)-violet leaf alcohol
CAS Number: 28069-72-9
Empirical Formula (Hill Notation): C9H16O
Molecular Weight: 140.22
EC Number: 248-816-8
MDL Number: MFCD00014055
Linear Formula: CH3CH2CH=CHCH2CH2CH=CHCH2OH
Product Type: Chemical
| agency |
follows IFRA guidelines |
| application(s) |
flavors and fragrances |
| assay |
≥95% |
| biological source |
synthetic |
| bp |
96-100 °C (lit.) |
| composition |
contains IFRA and EU1223/2009 restricted Benzyl Alcohol |
| density |
0.873 g/mL at 25 °C (lit.) |
| documentation |
see Safety & Documentation for available documents |
| food allergen |
no known allergens |
| fragrance allergen |
benzyl alcohol |
| grade |
FG |
| |
Fragrance grade |
| |
Halal |
| |
Kosher |
| InChI |
1S/C9H16O/c1-2-3-4-5-6-7-8-9-10/h3-4,7-8,10H,2,5-6,9H2,1H3/b4-3-,8-7+ |
| InChI key |
AMXYRHBJZOVHOL-ODYTWBPASA-N |
| may contain |
~0.10% alpha-tocopherol, synthetic as stabilizer |
| organoleptic |
cucumber; green; leafy; violet |
| Quality Level |
400  |
| refractive index |
n20/D 1.468 (lit.) |
| reg. compliance |
EU Regulation 1223/2009 |
| |
EU Regulation 1334/2008 & 178/2002 |
| |
FCC |
| SMILES string |
[H]C(CC)=C(/[H])CCC([H])=C(/[H])CO |
| General description: |
trans-2,cis-6-nonadien-1-ol has been identified in the volatile fractions of fresh-cut honeydews and melons. |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H315 |
| Hazard Codes |
Xi |
| Risk Statements |
38 |
| Safety Statements |
26-36-38 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
203.0 °F - closed cup |
| Flash Point(C) |
95 °C - closed cup |
| Purity |
≥95% |
| bp |
96-100 °C (lit.) |
| Density |
0.873 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.468 (lit.) |
| FEMA Number |
2780 |
| UNSPSC |
12164502 |
