Phenethyl phenylacetate
ALDRICH/W286605 - ≥98%, FCC, FG
Synonym: Benzyl carbinyl phenylacetate
CAS Number: 102-20-5
Empirical Formula (Hill Notation): C16H16O2
Molecular Weight: 240.30
EC Number: 203-013-1
MDL Number: MFCD00022049
Linear Formula: C6H5CH2CO2CH2CH2C6H5
Product Type: Chemical
| agency | meets purity specifications of JECFA |
| application(s) | flavors and fragrances |
| assay | ≥98% |
| biological source | synthetic |
| bp | 325 °C (lit.) |
| density | 1.082 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/C16H16O2/c17-16(13-15- |
| InChI key | ZOZIRNMDEZKZHM-UHFFFAOYSA |
| mp | 28 °C (lit.) |
| organoleptic | honey; floral; rose; sweet |
| Quality Level | 400  |
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FCC | |
| FDA 21 CFR 172.515 | |
| SMILES string | O=C(CC1=CC=CC=C1)OCCC2=CC |
| Application: | Phenethyl phenylacetate is a chemical compound with rose, honey, and other fruity aromas used in flavorings and fragrances. |
| General description: | Phenethyl phenylacetate is a fragrance ingredient belonging to the family of esters. Due to its pleasant and fruity aroma, it is commonly used as a flavoring and fragrance agent. Esters are mainly used in flower fragrance compositions and as fixatives. |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 5, 10 kg in poly drum |
| Symbol |  GHS09 |
| Hazard statements | H411 |
| Precautionary statements | P273 - P391 - P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | ≥98% |
| bp | 325 °C (lit.) |
| mp | 28 °C (lit.) |
| Density | 1.082 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2866 |
| UNSPSC | 12164502 |