(1R)-(+)-α-Pinene
ALDRICH/W290238 - 97%, FG
Synonym: (+)-α-Pinene; (1R,5R)
CAS Number: 7785-70-8
Empirical Formula (Hill Notation): C10H16
Molecular Weight: 136.23
EC Number: 232-087-8
MDL Number: MFCD00001346
Linear Formula: C10H16
Product Type: Chemical
ATR-IR Spectra for (1R,5R)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene.
| agency | follows IFRA guidelines |
| application(s) | flavors and fragrances |
| assay | 97% |
| autoignition temp. | 491 °F |
| biological source | synthetic |
| bp | 155-156 °C (lit.) |
| density | 0.858 g/mL at 20 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | α-pinene and β-pinene |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9( |
| InChI key | GRWFGVWFFZKLTI-RKDXNWHRSA |
| mp | −62 °C (lit.) |
| optical activity | [α]20/D +42°, neat |
| organoleptic | woody; camphoraceous; pine |
| Quality Level | 300  |
| 400 |
|
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 872/2012 | |
| SMILES string | CC1=CC[C@@H]2C[C@H]1C2(C) |
| General description: | (1R)-(+)- α-Pinene is a volatile monoterpene mainly found in the essential oil of aromatic plants. |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 20 kg in composite drum |
| Packaging: | 8 kg in steel drum |
| Symbol |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226 - H304 - H315 - H317 - H400 |
| Precautionary statements | P210 - P273 - P280 - P301 + P310 + P331 - P302 + P352 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2368 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 91.4 °F - closed cup |
| Flash Point(C) | 33 °C - closed cup |
| Purity | 97% |
| bp | 155-156 °C (lit.) |
| mp | −62 °C (lit.) |
| Density | 0.858 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2902 |
| UNSPSC | 12164502 |