Polysorbate 80
ALDRICH/W291706 - FG
Synonym: TWEEN® 80; POE (20) sorbitan monooleate; Polyethylene glycol sorbitan monooleate; Polyoxyethylenesorbitan monooleate; Polysorbate 80
CAS Number: 9005-65-6
MDL Number: MFCD00082107
Product Type: Chemical
| application(s) | flavors and fragrances |
| biological source | palm oil |
| synthetic | |
| density | 1.064 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | corn |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/C32H60O10/c1-2-3-4-5-6 |
| InChI key | RGPBUVUVZKQNHD-MDZDMXLPSA |
| organoleptic | alcohol |
| Quality Level | 300  |
| 400 |
|
| refractive index | n |
| reg. compliance | EU Regulation 1333/2008 & 178/2002 |
| FDA 21 CFR 172.515 | |
| FDA 21 CFR 172.836 | |
| FDA 21 CFR 172.838 | |
| FDA 21 CFR 172.840 | |
| FDA 21 CFR 172.842 | |
| SMILES string | CCCCCCCC/C=C/CCCCCCCC(=O) |
| vapor pressure | <1 mmHg ( 20 °C) |
| Application: | Polysorbate 80 (TWEEN® 80), a hydrophilic non-ionic surfactant, is widely employed as a surfactant and solubilizing agent in food and cosmetic industries. |
| General description: | Polysorbate 80 (TWEEN® 80) is a polyethylene sorbitol ester. |
| Legal Information: | TWEEN is a registered trademark of Croda International PLC |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 10, 25 kg in poly drum |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.064 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 2917 |
| UNSPSC | 12164502 |