Propyl gallate
ALDRICH/W294705 - ≥98%, FCC
Synonym: 3,4,5-
CAS Number: 121-79-9
Empirical Formula (Hill Notation): C10H12O5
Molecular Weight: 212.20
EC Number: 204-498-2
MDL Number: MFCD00002196
Linear Formula: 3,4,5-(HO)3C6H2CO2CH2CH2CH3
Product Type: Chemical
| agency | follows IFRA guidelines |
| application(s) | flavors and fragrances |
| assay | ≥98% |
| biological source | synthetic |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | no known allergens |
| grade | Fragrance grade |
| Halal | |
| Kosher | |
| InChI | 1S/C10H12O5/c1-2-3-15-10( |
| InChI key | ZTHYODDOHIVTJV-UHFFFAOYSA |
| mp | 146-149 °C (lit.) |
| organoleptic | odorless |
| Quality Level | 300 ![]() |
400 ![]() |
|
| reg. compliance | EU Regulation 1223/2009 |
| FCC | |
| FDA 21 CFR 172.615 | |
| FDA 21 CFR 175.125 | |
| FDA 21 CFR 175.300 | |
| FDA 21 CFR 175.380 | |
| FDA 21 CFR 175.390 | |
| FDA 21 CFR 184.1660 | |
| SMILES string | CCCOC(=O)c1cc(O)c(O)c(O)c |
| Disclaimer: | For R&D or non-EU Food use. Not for retail sale. |
| General description: | Propyl gallate is mainly used as an antioxidant for edible fats and vegetable oils. It occurs naturally in the pods of tara tree. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 10 kg in fiber drum |
| Preparation Note: | Prepare a 0.1M solution in glycerol:PBS (9:1) |
| Symbol | ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302 - H317 - H318 - H410 |
| Precautionary statements | P261 - P273 - P280 - P301 + P312 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 24-37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 368.6 °F - closed cup |
| Flash Point(C) | 187 °C - closed cup |
| Purity | ≥98% |
| mp | 146-149 °C (lit.) |
| FEMA Number | 2947 |
| UNSPSC | 12164502 |




