Terpineol
ALDRICH/W304506 - mixture of isomers, 96%, FG
Empirical Formula (Hill Notation): C10H18O
Molecular Weight: 154.25
EC Number: 232-268-1
MDL Number: MFCD00166983
Linear Formula: C10H18O
Product Type: Chemical
| agency | follows IFRA guidelines |
| application(s) | flavors and fragrances |
| assay | 96% |
| biological source | synthetic |
| bp | 213-218 °C (lit.) |
| composition | a-terpineol, ≥55.0% |
| b-terpineol, <10.0% (cis) | |
| b-terpineol, <13.0% (trans) | |
| d-terpineol, <1.0% | |
| g-terpineol, <23.0% | |
| density | 0.934 g/mL at 20 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| form | viscous liquid |
| fragrance allergen | terpineol (mixture of isomers), α-terpineol |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| InChI | 1S/2C10H18O/c1-8-4-6-9(7- |
| InChI key | MGABGZGUMNDCSN-UHFFFAOYSA |
| organoleptic | lilac; woody; floral; citrus; pine |
| Quality Level | 400  |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| FDA 21 CFR 172.515 | |
| FDA 21 CFR 178.1010 | |
| SMILES string | CC(=C)C1CCC(C)(O)CC1.CC2= |
| solubility | ethanol: soluble 1.25ml/10ml, clear to slightly hazy, colorless to light yellow (50% ethanol) |
| ethanol: soluble 2.5ml/10ml, clear to slightly hazy, colorless to light yellow | |
| ethanol: soluble 5mL/10mL, clear to slightly hazy, colorless to light yellow (70% Ethanol) |
| Application: | α-Terpineol is the suitable aroma standard used to study the influence of the drying method on volatile compounds of Origanum vulgare. It may be employed as a highly viscous solvent in the preparation of photocatalytic transparent TiO2 thin film. |
| General description: | α-Terpineol is a cyclic monoterpene. It is one of the major monoterpenol component of the cultivar Gewürztraminer and other aroma-rich grape varieties. α-Terpineol, a monoterpenoid alcohol, has been investigated for its anticonvulsant activity. It was one of the insecticidal constituent of the essential oils of Dahlia pinnata.FCC includes the following isomers in the listed purity: alpha-, (E)-beta, (Z)-beta, gamma-, terpinen-4-ol, and terpinen-1-ol. |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 10, 25 kg in composite drum |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 |
| Precautionary statements | P264 - P280 - P302 + P352 - P305 + P351 + P338 - P332 + P313 - P337 + P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Purity | 96% |
| bp | 213-218 °C (lit.) |
| Density | 0.934 g/mL at 20 °C (lit.) |
| FEMA Number | 3045 |
| UNSPSC | 12164502 |