Vanillin acetate
ALDRICH/W310808 - ≥98%, FG
Synonym: 4-
CAS Number: 881-68-5
Empirical Formula (Hill Notation): C10H10O4
Molecular Weight: 194.18
EC Number: 212-920-1
MDL Number: MFCD00003362
Linear Formula: CH3CO2C6H3-4-(CHO)-2-OCH3
Product Type: Chemical
| agency | meets purity specifications of JECFA |
| application(s) | flavors and fragrances |
| assay | ≥98% |
| biological source | synthetic |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/C10H10O4/c1-7(12)14-9- |
| InChI key | PZSJOBKRSVRODF-UHFFFAOYSA |
| mp | 77-79 °C (lit.) |
| organoleptic | creamy; sweet; vanilla |
| Quality Level | 300 ![]() |
400 ![]() |
|
| reg. compliance | EU Regulation 1334/2008 & 872/2012 |
| FDA 21 CFR 172.515 | |
| SMILES string | COc1cc(C=O)ccc1OC(C)=O |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 100 g in poly bottle |
| Packaging: | 5 kg in fiber drum |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% |
| mp | 77-79 °C (lit.) |
| FEMA Number | 3108 |
| UNSPSC | 12164502 |

