Ethyl 2-trans-4-cis-decadienoate
ALDRICH/W314811 - natural, ≥95%, FG
CAS Number: 3025-30-7
Empirical Formula (Hill Notation): C12H20O2
Molecular Weight: 196.29
EC Number: 221-178-8
MDL Number: MFCD00082225
Linear Formula: CH3(CH2)4CH=CHCH=CHCO2C2H5
Product Type: Chemical
| agency | follows IFRA guidelines |
| meets purity specifications of JECFA | |
| application(s) | flavors and fragrances |
| assay | ≥95% |
| bp | 70-72 °C/0.05 mmHg (lit.) |
| density | 0.905 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | no known allergens |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| natural | |
| InChI | 1S/C12H20O2/c1-3-5-6-7-8- |
| InChI key | OPCRGEVPIBLWAY-QNRZBPGKSA |
| organoleptic | apple; fatty; green; sweet |
| Quality Level | 400  |
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| SMILES string | [H]C(CCCCC)=C([H])C([H] |
| Application: | Potential applications include the profile enhancement of guava, melon, pear, apple, banana, kiwi, grape, golden delicious apple, fruit cocktail juices, fruit nectar, mamey and other tropical backgrounds. |
| Biochem/physiol Actions: | Odor at 1.0% |
| Biochem/physiol Actions: | Taste at 5 ppm |
| General description: | Natural occurrence: Apple, pear, grape, pear brandy and quince. |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 25, 100 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H412 |
| Precautionary statements | P273 - P302 + P352 |
| Hazard Codes | Xi,N |
| Risk Statements | 38-50/53 |
| Safety Statements | 60-61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | ≥95% |
| bp | 70-72 °C/0.05 mmHg (lit.) |
| Density | 0.905 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 3148 |
| UNSPSC | 12164502 |