Synonym: (E,E)-2,4-nonadienal; trans,trans-2,4-nonadiene aldehyde
CAS Number: 5910-87-2
Empirical Formula (Hill Notation): C9H14O
Molecular Weight: 138.21
EC Number: 227-629-5
MDL Number: MFCD00007006
Linear Formula: CH3(CH2)3CH=CHCH=CHCHO
Product Type: Chemical
| application(s) |
flavors and fragrances |
| assay |
≥89% |
| biological source |
synthetic |
| bp |
97-98 °C/10 mmHg (lit.) |
| density |
0.862 g/mL at 25 °C (lit.) |
| documentation |
see Safety & Documentation for available documents |
| food allergen |
no known allergens |
| grade |
FG |
| |
Kosher |
| InChI |
1S/C9H14O/c1-2-3-4-5-6-7-8-9-10/h5-9H,2-4H2,1H3/b6-5+,8-7+ |
| InChI key |
ZHHYXNZJDGDGPJ-BSWSSELBSA-N |
| organoleptic |
fatty; green; melon; floral |
| Quality Level |
300  |
| |
400 |
| refractive index |
n20/D 1.5207 (lit.) |
| reg. compliance |
EU Regulation 1334/2008 & 178/2002 |
| SMILES string |
[H]C(=O)C([H])=C([H])C([H])=C(/[H])CCCC |
| vapor density |
>1 (vs air) |
| Biochem/physiol Actions: |
Odor at 1.0% |
| Biochem/physiol Actions: |
Taste at 2 ppm |
| Other Notes: |
Natural occurrence: Avocado, Brazil nut, caviar, cooked beef, chicken and pork, cooked lamb/mutton, fish, milk and roasted peanut. |
| Packaging: |
1 kg in glass bottle |
| Packaging: |
25, 100 g in glass bottle |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
186.8 °F - closed cup |
| Flash Point(C) |
86 °C - closed cup |
| Purity |
≥89% |
| bp |
97-98 °C/10 mmHg (lit.) |
| Density |
0.862 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.5207 (lit.) |
| FEMA Number |
3212 |
| UNSPSC |
12164502 |
