Synonym: (+)-arabinose; (2R,3S,4S)-2,3,4,5-tetrahydroxypentanal; L(+)-Pectinose; L-arabino-pentose; Pectin sugar
CAS Number: 5328-37-0
Empirical Formula (Hill Notation): C5H10O5
Molecular Weight: 150.13
EC Number: 226-214-6
MDL Number: MFCD00135866
Linear Formula: C5H10O5
Product Type: Chemical
| application(s) |
flavors and fragrances |
| assay |
99% |
| biological source |
synthetic |
| food allergen |
no known allergens |
| InChI |
1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5+/m0/s1 |
| InChI key |
PYMYPHUHKUWMLA-VAYJURFESA-N |
| mp |
160-163 °C (lit.) |
| optical activity |
[α]/D 102 to 105°, c = 10 in H2O (24 hours) |
| organoleptic |
woody |
| Quality Level |
300  |
| SMILES string |
OC[C@H](O)[C@H](O)[C@@H](O)C=O |
| Biochem/physiol Actions: |
L-Arabinose is the naturally occurring isomer and is a constituent of plant polysaccharides. Most bacteria contain an inducible arabinose operon that codes for a series of enzymes and transporters that allows L-arabinose to be used as the sole carbon source in microbial culture. |
| Disclaimer: |
For R&D or non-EU Food use. Not for retail sale. |
| General description: |
L-(+)-Arabinose is a pentose sugar that occurs naturally in corn fiber gum and acacia gum. |
| Packaging: |
1 kg in poly bottle |
| Packaging: |
100 g in poly bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
99% |
| mp |
160-163 °C (lit.) |
| FEMA Number |
3255 |
| UNSPSC |
12164502 |
