2-Methoxy-3(5 or 6)-isopropylpyrazine
ALDRICH/W335809 - ≥98%, FG
Synonym: 3,5 Or 6-
CAS Number: 93905-03-4
Empirical Formula (Hill Notation): C8H12N2O
Molecular Weight: 152.19
EC Number: 299-837-4
MDL Number: MFCD08056067
Linear Formula: C8H12N2O
Product Type: Chemical
| application(s) | flavors and fragrances |
| assay | ≥98% |
| biological source | synthetic |
| density | 0.996 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/3C8H12N2O/c1-6(2)7-4-1 |
| InChI key | MQHZLANELJKBBO-UHFFFAOYSA |
| organoleptic | green; earthy; pea; pepper |
| Quality Level | 300  |
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| FDA 21 CFR 117 | |
| SMILES string | COc1cnc(cn1)C(C)C.COc2cnc |
| General description: | 2-Methoxy-3(5or 6)-isopropylpyrazine is a mixture of positional isomers commonly used as a flavoring agent in the food industry. Pyrazine derivatives exhibit a wide variety of aromas in food. For instance, 2-methoxy-3-isopropyl pyrazine produces a green pea odor and earthy and beany flavors . In addition, they are naturally found in coffee beans, cocoa beans, nuts, and vegetables. |
| Packaging: | 100 g in glass bottle |
| Packaging: | 25 g in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P261 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| Flash Point(F) | 152.6 °F |
| Flash Point(C) | 67 °C |
| Purity | ≥98% |
| Density | 0.996 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 3358 |
| UNSPSC | 12164502 |