Fenchyl acetate, mixture of α- and β-
ALDRICH/W339008 - ≥96%, FG
Synonym: 1,3,3-
CAS Number: 13851-11-1
Empirical Formula (Hill Notation): C12H20O2
Molecular Weight: 196.29
EC Number: 237-588-5
MDL Number: MFCD00083571
Linear Formula: C12H20O2
Product Type: Chemical
| application(s) | flavors and fragrances |
| assay | ≥96% |
| biological source | synthetic |
| bp | 220 °C (lit.) |
| density | 0.98 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| InChI | 1S/C12H20O2/c1-8(13)14-10 |
| InChI key | JUWUWIGZUVEFQB-MAZPRZIYSA |
| optical activity | [α]22/D +54°, neat |
| organoleptic | balsamic; pine; sweet |
| Quality Level | 300  |
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 872/2012 |
| SMILES string | CC(=O)OC1C(C)(C)[C@@H]2CC |
| Application: | Fenchyl acetate, a mixture of α- and β- contributes to the overall aroma and flavor profile of Alpinia calcarata . |
| General description: | Fenchyl acetate is a fragrance ingredient found in many fragrance compounds including fine fragrances, decorative cosmetics, shampoos, toilet soaps, and other toiletries . |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 5, 10 kg in poly drum |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 168.8 °F - closed cup |
| Flash Point(C) | 76 °C - closed cup |
| Purity | ≥96% |
| bp | 220 °C (lit.) |
| Density | 0.98 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 3390 |
| UNSPSC | 12164502 |