Butyl 2-methylbutyrate
ALDRICH/W339318 - ≥97%, FG
Synonym: N-butyl 2-methylbutyrate
CAS Number: 15706-73-7
Empirical Formula (Hill Notation): C9H18O2
Molecular Weight: 158.24
EC Number: 239-798-2
MDL Number: MFCD00042902
Linear Formula: CH3CH2CH(CH3)COOCH2CH2CH2CH3
Product Type: Chemical
| agency | follows IFRA guidelines |
| meets purity specifications of JECFA | |
| application(s) | flavors and fragrances |
| assay | ≥97% |
| biological source | synthetic |
| bp | 173-176 °C/730 mmHg (lit.) |
| density | 0.863 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | no known allergens |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| InChI | 1S/C9H18O2/c1-4-6-7-11-9( |
| InChI key | OTKQNSSMCDLVQV-UHFFFAOYSA |
| organoleptic | tropical; fruity; sweet |
| Quality Level | 400  |
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| SMILES string | CCCCOC(=O)C(C)CC |
