3-(Methylthio)-1-hexanol
ALDRICH/W343847 - natural, ≥98%, FG
CAS Number: 51755-66-9
Empirical Formula (Hill Notation): C7H16OS
Molecular Weight: 148.27
EC Number: 257-380-8
MDL Number: MFCD00010674
Linear Formula: CH3CH2CH2CH(SCH3)CH2CH2OH
Product Type: Chemical
| agency | follows IFRA guidelines |
| meets purity specifications of JECFA | |
| application(s) | flavors and fragrances |
| assay | ≥98% |
| biological source | botanical |
| bp | 61-62 °C/10 mmHg (lit.) |
| density | 0.966 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| fragrance allergen | no known allergens |
| grade | FG |
| Fragrance grade | |
| Halal | |
| Kosher | |
| natural | |
| InChI | 1S/C7H16OS/c1-3-4-7(9-2)5 |
| InChI key | JSASXSHMJYRPCM-UHFFFAOYSA |
| organoleptic | green; vegetable; spicy; pungent; earthy; sulfurous |
| Quality Level | 400  |
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| FDA 21 CFR 117 | |
| SMILES string | CCCC(CCO)SC |
