4-Ethyloctanoic acid
ALDRICH/W380008 - ≥98%, FG
CAS Number: 16493-80-4
Empirical Formula (Hill Notation): C10H20O2
Molecular Weight: 172.26
EC Number: 240-560-5
MDL Number: MFCD00506494
Linear Formula: CH3(CH2)3CH(C2H5)(CH2)2CO2H
Product Type: Chemical
| application(s) | flavors and fragrances |
| assay | ≥98% |
| biological source | synthetic |
| bp | 163 °C (lit.) |
| density | 0.904 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | no known allergens |
| grade | FG |
| Halal | |
| Kosher | |
| InChI | 1S/C10H20O2/c1-3-5-6-9(4- |
| InChI key | PWKJMPFEQOHBAC-UHFFFAOYSA |
| organoleptic | meaty |
| Quality Level | 300 ![]() |
400 ![]() |
|
| refractive index | n |
| reg. compliance | EU Regulation 1334/2008 & 178/2002 |
| SMILES string | CCCCC(CC)CCC(O)=O |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 100 g in glass bottle |
| Packaging: | 25 g in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Purity | ≥98% |
| bp | 163 °C (lit.) |
| Density | 0.904 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| FEMA Number | 3800 |
| UNSPSC | 12164502 |


