N-Acetyl-L-methionine
SIAL/01310 - ≥98.5% (T)
Synonym: N-acetyl-L-lysine
CAS Number: 65-82-7
Empirical Formula (Hill Notation): C7H13NO3S
Molecular Weight: 191.25
EC Number: 200-617-7
MDL Number: MFCD00064441
Linear Formula: CH3SCH2CH2CH(NHCOCH3)CO2H
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | ≥98.5% (T) |
| ≥98.5% (TLC) | |
| form | powder or crystals |
| InChI | 1S/C7H13NO3S/c1-5(9)8-6(7 |
| InChI key | XUYPXLNMDZIRQH-LURJTMIESA |
| mp | 103-106 °C (lit.) |
| optical activity | [α]20/D -21.0±1.0°, c = 1% in H2O |
| Quality Level | 100  |
| reaction suitability | reaction type: solution phase peptide synthesis |
| SMILES string | CSCC[C@H](NC(C)=O)C(O)=O |
| solubility | methanol: 50 mg/mL, clear to very slightly hazy, colorless |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.5% (T); ≥98.5% (TLC) |
| mp | 103-106 °C (lit.) |
| UNSPSC | 12352209 |