Synonym: (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol
CAS Number: 3371-27-5
Empirical Formula (Hill Notation): C15H14O7
Molecular Weight: 306.27
MDL Number: MFCD01632616
Linear Formula: C15H14O7
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥97.0% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15+/m1/s1 |
| InChI key |
XMOCLSLCDHWDHP-DOMZBBRYSA-N |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
O[C@@H]1Cc2c(O)cc(O)cc2O[C@H]1c3cc(O)c(O)c(O)c3 |
| storage temp. |
2-8°C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
(−)-Gallocatechin may be used as an analytical standard for the determination of the analyte in biological fluids and tea beverages by chromatography-based techniques. |
| General description: |
Gallocatechin belongs to the catechin class of organic compounds and is one of the major components of green tea. The beneficial effects of catechins include anti-tumorigenic, anti-mutagenic, anti-pathogenic, and anti-oxidative properties. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| Purity |
≥97.0% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
85151701 |
GHS07