Bis(2-ethylhexyl) adipate
SIAL/02138 - Selectophore™, ≥99.0%
Synonym: Adipic acid di(2-ethylhexyl) ester; DOA
CAS Number: 103-23-1
Empirical Formula (Hill Notation): C22H42O4
Molecular Weight: 370.57
EC Number: 203-090-1
MDL Number: MFCD00009496
Linear Formula: [-CH2CH2CO2CH2CH(C2H5)(CH2)3CH3]2
Product Type: Chemical
| assay | ≥99.0% |
| ≥99.0% (GC) | |
| bp | 175 °C/2 mmHg (lit.) |
| density | 0.925 g/mL at 20 °C (lit.) |
| grade | for ion-selective electrodes |
| InChI | 1S/C22H42O4/c1-5-9-13-19( |
| InChI key | SAOKZLXYCUGLFA-UHFFFAOYSA |
| mp | <−70 °C (lit.) |
| product line | Selectophore™ |
| Quality Level | 200  |
| refractive index | n |
| SMILES string | CCCCC(CC)COC(=O)CCCCC(=O) |
| General description: | Visit our Sensor Applications portal to learn more. |
| Legal Information: | Selectophore is a trademark of Merck KGaA, Darmstadt, Germany |
| Other Notes: | Plasticizer employed in polymeric membrane electrodes |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 384.8 °F - closed cup |
| Flash Point(C) | 196 °C - closed cup |
| Purity | ≥99.0% (GC); ≥99.0% |
| bp | 175 °C/2 mmHg (lit.) |
| mp | <−70 °C (lit.) |
| Density | 0.925 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 26111700 |