Bis(2-ethylhexyl) adipate
SIAL/02140 - ≥97.0% (GC)
Synonym: Adipic acid di(2-ethylhexyl) ester; DOA
CAS Number: 103-23-1
Empirical Formula (Hill Notation): C22H42O4
Molecular Weight: 370.57
EC Number: 203-090-1
MDL Number: MFCD00009496
Linear Formula: [-CH2CH2CO2CH2CH(C2H5)(CH2)3CH3]2
Product Type: Chemical
| assay | ≥97.0% (GC) |
| bp | 175 °C/2 mmHg (lit.) |
| density | 0.925 g/mL at 20 °C (lit.) |
| form | liquid |
| functional group | ester |
| InChI | 1S/C22H42O4/c1-5-9-13-19( |
| InChI key | SAOKZLXYCUGLFA-UHFFFAOYSA |
| mp | <−70 °C (lit.) |
| Quality Level | 100 ![]() |
500 ![]() |
|
| refractive index | n |
| n |
|
| SMILES string | CCCCC(CC)COC(=O)CCCCC(=O) |
| Application: | Bis(2-ethylhexyl) adipate also known as dioctyl adipate (DOA) can be used as a plasticizer for improving the impact properties of polymers. DOA is also used to produce clear films for food packaging applications and in synthetic rubber industries due to its compatibility with nitrocellulose and ethylcellulose. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 384.8 °F - closed cup |
| Flash Point(C) | 196 °C - closed cup |
| Purity | ≥97.0% (GC) |
| bp | 175 °C/2 mmHg (lit.) |
| mp | <−70 °C (lit.) |
| Density | 0.925 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |

