Phosphomolybdic acid solution
SIAL/02553 - ready-to-use spray and plunge reagent
Synonym: Molybdophosphoric acid
CAS Number: 12026-57-2
Empirical Formula (Hill Notation): H3Mo12O40P
Molecular Weight: 1825.25
MDL Number: MFCD00011341
Linear Formula: H3[P(Mo3O10)4]
Product Type: Chemical
| application(s) | diagnostic assay manufacturing hematology histology |
| form | liquid |
| InChI | 1S/12Mo.H3O4P.36O/c;;;;;; |
| InChI key | DHRLEVQXOMLTIM-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| reaction suitability | reagent type: oxidant |
| SMILES string | O=[Mo](=O)=O.O=[Mo](=O)=O |
| storage temp. | room temp |
| suitability | suitable for chromatography |
| Application: | Phosphomolybdic acid solution is a ready-to-use spray for the visualization of steroids, alkaloids, antioxidants, and terpenes resolved by thin-layer chromatography (TLC) and high-performance TLC (HPTLC). |
| General description: | Phosphomolybdic acid solution (PMA), a ready-to-use spray solution is a component of Masson′s trichrome stain. It functions as a mordant, forming a bridge between the substrate and the primary dye. |
| Symbol | ![]() ![]() ![]() GHS02,GHS03,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225 - H272 - H314 - H336 |
| Precautionary statements | P210 - P220 - P233 - P280 - P303 + P361 + P353 - P305 + P351 + P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/38-67 |
| Safety Statements | 16-26 |
| RIDADR | UN 2924 8(3) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 53.6 °F - closed cup |
| Flash Point(C) | 12.0 °C - closed cup |
| Storage Temp. | room temp |
| UNSPSC | 12171500 |





