1-Ethyl-3-methylimidazolium trifluoromethanesulfonate
SIAL/04367 - ≥98.0% (T)
Synonym: [EMIM][TRIFLATE]; EMIM Otf
CAS Number: 145022-44-2
Empirical Formula (Hill Notation): C7H11F3N2O3S
Molecular Weight: 260.23
MDL Number: MFCD00210008
Linear Formula: C7H11F3N2O3S
Product Type: Chemical
| assay | ≥98.0% (T) |
| bp | >350 °C (lit.) |
| density | 1.387 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | fluoro |
| triflate | |
| impurities | ≤0.1% water |
| InChI | 1S/C6H11N2.CHF3O3S/c1-3-8 |
| InChI key | ZPTRYWVRCNOTAS-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| n |
|
| SMILES string | CCn1cc[n+](C)c1.[O-]S(=O) |
| Application: | 1-Ethyl-3-methylimidazoli |
| Other Notes: | Ionic liquid stable to air and water useful for electrochemical purposes (molten salt technique) exhibiting an electrochemical stability window of ≥4 V and being stable to up to 350 C |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 425.3 °F - closed cup |
| Flash Point(C) | 218.5 °C - closed cup |
| Purity | ≥98.0% (T) |
| bp | >350 °C (lit.) |
| Density | 1.387 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |

