(−)-Menthone
SIAL/04660585 - primary reference standard
Synonym: (1R,4S)-p-Menthan-3-one; (2S,5R)
CAS Number: 14073-97-3
Empirical Formula (Hill Notation): C10H18O
Molecular Weight: 154.25
EC Number: 237-926-1
MDL Number: MFCD00001634
Linear Formula: C10H18O
Product Type: Chemical
| application(s) | food and beverages |
| bp | 207-210 °C (lit.) |
| density | 0.893 g/mL at 20 °C (lit.) |
| grade | primary reference standard |
| InChI | 1S/C10H18O/c1-7(2)9-5-4-8 |
| InChI key | NFLGAXVYCFJBMK-BDAKNGLRSA |
| manufacturer/tradename | HWI |
| refractive index | n |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(C)[C@@H]1CC[C@@H](C)CC |
| storage temp. | −20°C |
| vapor pressure | 0.5 mmHg ( 20 °C) |
| Application: | Reference Standard in the analysis of herbal medicinal products |
| General description: | Produced and qualified by HWI pharma services GmbH. Exact content by quantitative NMR can be found on the certificate. |
| Other Notes: | This compound is commonly found in plants of the genus: mentha |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H317 |
| Precautionary statements | P280 - P302 + P352 |
| Hazard Codes | Xi |
| Risk Statements | 38-43 |
| Safety Statements | 36/37 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | WGK 1 |
| Flash Point(F) | 165.2 °F |
| Flash Point(C) | 74 °C |
| bp | 207-210 °C (lit.) |
| Density | 0.893 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | −20°C |
| UNSPSC | 85151701 |