L-Alanine tert-butyl ester hydrochloride
SIAL/05190 - ≥99.0% (AT)
Synonym: (S)-2-Aminopropionic acid tert-butyl ester hydrochloride; L-Ala-OtBu·HCl
CAS Number: 13404-22-3
Empirical Formula (Hill Notation): C7H15NO2 · HCl
Molecular Weight: 181.66
EC Number: 236-497-8
MDL Number: MFCD00035524
Linear Formula: CH3CH(NH2)COOC(CH3)3 · HCl
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | ≥99.0% (AT) |
| color | white to off-white |
| form | powder |
| InChI | 1S/C7H15NO2.ClH/c1-5(8)6( |
| InChI key | WIQIWPPQGWGVHD-JEDNCBNOSA |
| mp | 168-175 °C |
| optical activity | [α]20/D +1.4±0.2°, c = 2% in ethanol |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: solution phase peptide synthesis |
| SMILES string | Cl.C[C@H](N)C(=O)OC(C)(C) |
| storage temp. | 2-8°C |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (AT) |
| mp | 168-175 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352209 |

