Synonym: (R)-β-Tocotrienol; [R-(E,E)]-3,4-Dihydro-2,5,8-trimethyl-2-(4,8,12-trimethyl-3,7,11-tridecatrienyl)-2H-1-benzopyran-6-ol
CAS Number: 490-23-3
Empirical Formula (Hill Notation): C28H42O2
Molecular Weight: 410.63
EC Number: 207-708-0
MDL Number: MFCD09264634
Linear Formula: C28H42O2
Product Type: Chemical
| application(s) |
vitamins, nutraceuticals, and natural products |
| assay |
≥95.0% (HPLC) |
| biological source |
Elaeis guineensis |
| color |
colorless to amber |
| form |
liquid |
| |
viscous liquid |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C28H42O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-24(6)26(29)19-23(5)27(25)30-28/h11,13,15,19,29H,8-10,12,14,16-18H2,1-7H3/b21-13+,22-15+/t28-/m1/s1 |
| InChI key |
FGYKUFVNYVMTAM-WAZJVIJMSA-N |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
CC(C)=CCCC(C)=CCCC(C)=CCC[C@]1(C)CCc2c(C)c(O)cc(C)c2O1 |
| storage temp. |
−20°C |
| Application: |
β-Tocotrienol may be used as an analytical reference standard for the quantification of the analyte in chicken meat samples using liquid chromatography technique. |
| General description: |
β-Tocotrienol is a naturally occurring forms of vitamin E commonly found in cereals such as whole wheat flour. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95.0% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
85151701 |
