N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate
SIAL/09668 - ≥99.0% (TLC/N)
Synonym: O-(N-Succinimidyl)-N,N,N′,N′-tetramethyluronium hexafluorophosphate; HSTU
CAS Number: 265651-18-1
Empirical Formula (Hill Notation): C9H16F6N3O3P
Molecular Weight: 359.21
MDL Number: MFCD01863753
Linear Formula: C9H16F6N3O3P
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | ≥99.0% (TLC/N) |
| form | crystals |
| InChI | 1S/C9H16N3O3.F6P/c1-10(2) |
| InChI key | STWZCCVNXFLDDD-UHFFFAOYSA |
| mp | 218-221 °C (dec.) |
| reaction suitability | reaction type: Coupling Reactions |
| SMILES string | F[P-](F)(F)(F)(F)F.CN(C)C |
| solubility | acetonitrile: 0.5 g/mL, slightly hazy, colorless |
| storage temp. | −20°C |
| Application: | Reactant for: Synthesis of liposomal contrast agents for magnetic resonance imaging Synthesis of thiol-reactive Cy5 derivatives Synthesis of protein labeling molecules |
| General description: | N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate can be used to prepare N-succinimidyl 4-[18F]fluorobenzoate ([18F]-SFB), a prosthetic group for the fluorination of biomolecules for PET imaging. |
| Other Notes: | Coupling reagent for peptide synthesis and the formation of other amides. Even in aqueous solution yields are excellent |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (TLC/N) |
| mp | 218-221 °C (dec.) |
| Storage Temp. | −20°C |
| UNSPSC | 12352101 |