Tris(2-butoxyethyl) phosphate
SIAL/14482 - analytical standard
Synonym: Phosphoric acid tris(2-butoxyethyl) ester
CAS Number: 78-51-3
Empirical Formula (Hill Notation): C18H39O7P
Molecular Weight: 398.47
EC Number: 201-122-9
MDL Number: MFCD00009456
Linear Formula: [CH3(CH2)3OCH2CH2O]3P(O)
Product Type: Chemical
| application(s) | environmental |
| assay | ≥95.0% (GC) |
| bp | 215-228 °C/4 mmHg (lit.) |
| density | 1.006 g/mL at 25 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C18H39O7P/c1-4-7-10-20 |
| InChI key | WTLBZVNBAKMVDP-UHFFFAOYSA |
| Quality Level | 100  |
| refractive index | n |
| n |
|
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CCCCOCCOP(=O)(OCCOCCCC)OC |
| vapor density | 13.7 (vs air) |
| vapor pressure | 0.03 mmHg ( 150 °C) |
| Application: | Tris(2-butoxyethyl) phosphate may be used as an analytical reference standard for the quantification of the analyte in herring gull eggs, house dust, and urine samples using liquid chromatography technique. |
| General description: | Tris(2-butoxyethyl) phosphate belongs to the class of organophosphate triesters, widely used as flame retardants and plasticizers in a variety of commercial products such as textiles, foams, polymers, paints, hydraulic fluids, etc. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 318.2 °F - closed cup |
| Flash Point(C) | 159 °C - closed cup |
| Purity | ≥95.0% (GC) |
| bp | 215-228 °C/4 mmHg (lit.) |
| Density | 1.006 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352200 |