1,2-Bis(2-aminophenoxy)ethane-N,N,N′,N′-tetraacetic acid
SIAL/14510 - ≥96.0% (HPLC)
Synonym: BAPTA; Ethylenedioxybis(o-
CAS Number: 85233-19-8
Empirical Formula (Hill Notation): C22H24N2O10
Molecular Weight: 476.43
MDL Number: MFCD00036255
Linear Formula: C22H24N2O10
Product Type: Chemical
| assay | ≥96.0% (HPLC) |
| fluorescence | λex 251 nm; λem 363 nm |
| λex 274 nm; λem 363 nm (With Calcium) | |
| form | powder |
| functional group | amine |
| carboxylic acid | |
| InChI | 1S/C22H24N2O10/c25-19(26) |
| InChI key | FTEDXVNDVHYDQW-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| SMILES string | OC(=O)CN(CC(O)=O)c1ccccc1 |
| storage temp. | 2-8°C |
| Application: | 1,2-Bis(2-aminophenoxy)et |
| Application: | Highly selective calcium chelating reagent. Suitable for the spectrophotometric monitoring of Ca2+ levels |
| General description: | 1,2-Bis(2-aminophenoxy)et |
| General description: | pH 8.0 Highly selective calcium chelating reagent. Suitable for the spectrophotometric monitoring of Ca2+ levels |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥96.0% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352112 |

