Synonym: 3,3′-Dimethyl-1,1′-diphenyl-(4,4′-bi-2-pyrazoline)-5,5′-dione
CAS Number: 7477-67-0
Empirical Formula (Hill Notation): C20H18N4O2
Molecular Weight: 346.38
EC Number: 231-282-5
MDL Number: MFCD00020765
Linear Formula: C20H18N4O2
Product Type: Chemical
| assay |
≥98.0% |
| |
≥98.0% (TLC) |
| form |
powder |
| grade |
for TLC derivatization |
| InChI |
1S/C20H18N4O2/c1-13-17(19(25)23(21-13)15-9-5-3-6-10-15)18-14(2)22-24(20(18)26)16-11-7-4-8-12-16/h3-12,17-18H,1-2H3 |
| InChI key |
FORCWSNQDMPPOC-UHFFFAOYSA-N |
| quality |
for the det.of cyanide |
| Quality Level |
100  |
| SMILES string |
CC1=NN(c2ccccc2)C(=O)C1C3C(C)=NN(c4ccccc4)C3=O |
| solubility |
formic acid: 50 mg/mL, clear, yellow |
| technique(s) |
thin layer chromatography (TLC): suitable |
| Application: |
Bispyrazolone was used in an experimental procedure, done in order to remove linamarin in starch from cassava roots, by using plant cell wall-degrading enzymes, xylanase and cellulase. It was also used for spectrophotometric determination and quantization of urea in urine samples. |
| Other Notes: |
Determination of ammonia; Assay of cyanogenic compounds |
| Hazard Codes |
Xi |
| Risk Statements |
43 |
| Safety Statements |
36/37 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (TLC); ≥98.0% |
| UNSPSC |
41116105 |
