| agency |
meets analytical specifications of BP |
| |
meets analytical specifications of NF |
| |
meets analytical specifications of Ph. Eur. |
| anion traces |
chloride (Cl-): ≤30 mg/kg |
| |
sulfate (SO42-): ≤60 mg/kg |
| |
sulfite (SO32-): ≤10 mg/kg |
| application(s) |
pharmaceutical (small molecule) |
| biological source |
plant |
| cation traces |
Ca:, in accordance |
| |
Pb: ≤0.5 mg/kg |
| color |
white |
| conductivity |
≤35 μS/cm |
| description |
color index <= 45 |
| form |
solid |
| grade |
puriss. |
| ign. residue |
≤0.01% (as SO4) |
| impurities |
dextrine, complies |
| |
invert sugar, complies |
| |
organic volatile impurities, in accordance (GC) |
| |
reducing sugar, complies |
| |
residual solvents, complies |
| |
≤0.0005% heavy metals (as Pb) |
| |
≤0.0035% Chloride (Cl) |
| |
≤0.006% Sulfate (SO4) |
| |
≤10 ppm Sulfite (SO2) |
| |
≤250 EU/g endotoxins (LAL test) |
| |
≤5 ppm Heavy Metals (lead) |
| InChI |
1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChI key |
CZMRCDWAGMRECN-UGDNZRGBSA-N |
| loss |
≤0.1% loss on drying, 105 °C, 3 h |
| mp |
185 - 187 °C ((365 - 369 °F )) |
| |
185-187 °C (lit.) |
| optical activity |
[α]20/D +66.3 to +67.0°, c = 26% in H2O |
| quality |
meets analytical specification of Ph. Eur., BP, NF |
| Quality Level |
200  |
| SMILES string |
OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| solubility |
alcohol: insoluble (Dehydrated) |
| |
alcohol: soluble 1 gm in 170 ml |
| |
glycerol: moderately soluble |
| |
H2O: 342 g/L at 20 °C |
| |
methanol: soluble 1 gm in 100ml |
| |
pyridine: moderately soluble |
| suitability |
complies for appearance of solution |
| useful pH range |
5.5-7 (25 °C, 342 g/L) |
).