Synonym: β-Rhamnocitrin; 3,3′,4′,5-Tetrahydroxy 7-methoxyflavone; 7-Methoxyquercetin; 7-Methylquercetin; Quercetin 7-methyl ether
CAS Number: 90-19-7
Empirical Formula (Hill Notation): C16H12O7
Molecular Weight: 316.26
EC Number: 201-974-1
MDL Number: MFCD00016931
Linear Formula: C16H12O7
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥99.0% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 |
| InChI key |
JGUZGNYPMHHYRK-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
COc1cc(O)c2C(=O)C(O)=C(Oc2c1)c3ccc(O)c(O)c3 |
| storage temp. |
2-8°C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26-36/37 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99.0% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
85151701 |
