Phenosafranin
SIAL/199648 - Dye content 80 %
Synonym: 3,7-
CAS Number: 81-93-6
Empirical Formula (Hill Notation): C18H15ClN4
Molecular Weight: 322.79
EC Number: 201-387-0
MDL Number: MFCD00036335
Linear Formula: C18H15ClN4
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 199648-1G
| λmax | 519 nm |
| application(s) | diagnostic assay manufacturing hematology histology |
| composition | Dye content, 80% |
| form | powder |
| InChI | 1S/C18H14N4.ClH/c19-12-6- |
| InChI key | SOUHUMACVWVDME-UHFFFAOYSA |
| mp | >300 °C (lit.) |
| SMILES string | [Cl-].Nc1ccc2nc3ccc(N)cc3 |
| storage temp. | room temp |
| technique(s) | titration: suitable |
| Application: | Phenosafranin has been used for nuclear staining. |
| Biochem/physiol Actions: | Phenosafranin (PSF) is a red dye released from cells with intact plasma membrane. PSF at lower concentration is used to stain mitochondria supravitally. |
| Packaging: | 1 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | >300 °C (lit.) |
| Storage Temp. | room temp |
| Colour Index Number | 50200 |
| UNSPSC | 12171500 |