Cesium carbonate
SIAL/20959 - puriss. p.a., ≥99.0%
Synonym: Carbonic acid dicesium
CAS Number: 534-17-8
Empirical Formula (Hill Notation): CCs2O3
Molecular Weight: 325.82
EC Number: 208-591-9
MDL Number: MFCD00010957
Linear Formula: Cs2CO3
Product Type: Chemical
| anion traces | chloride (Cl-): ≤20 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.0% |
| ≥99.0% (T) | |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| grade | puriss. p.a. |
| impurities | ≤0.002% total nitrogen (N) |
| InChI | 1S/CH2O3.2Cs/c2-1(3)4;;/h |
| InChI key | FJDQFPXHSGXQBY-UHFFFAOYSA |
| mp | 610 °C (dec.) (lit.) |
| Quality Level | 100  |
| SMILES string | [Cs+].[Cs+].[O-]C([O-])=O |
| Application: | Cesium carbonate, an alkali metal carbonate, is a commonly used inorganic base in organic reactions. Synthetic applications: • As a catalyst to synthesize quinazoline-2,4(1H,3H)-diones from substituted 2-aminobenzonitriles and carbon dioxide. • As a base to synthesize cyclic carbonates using halo- or tosyl-alcohols and carbon dioxide in the absence of any transition metal or organo catalyst. • In combination with alkyl halide and acetonitrile, it forms an effective system for the alkylation method of phenols. |
| Application: | Promotes the efficient O-alkylation of alcohols to form mixed alkyl carbonates. |
| General description: | Cesium carbonate is an inorganic base generally used in C, N, O-arylation and alkylation reactions. It is also used in six-membered annulation, cross-coupling, intramolecular and intermolecular cyclizations, aza-Henry reaction, Horner-Emmons cyclization, and cycloaddition reactions. |
| Symbol |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H318 - H361f - H373 |
| Precautionary statements | P201 - P202 - P260 - P280 - P305 + P351 + P338 - P308 + P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (T); ≥99.0% |
| mp | 610 °C (dec.) (lit.) |
| UNSPSC | 12352301 |