Cesium carbonate
SIAL/20960 - purum p.a., ≥98.0% (T)
Synonym: Carbonic acid dicesium
CAS Number: 534-17-8
Empirical Formula (Hill Notation): CCs2O3
Molecular Weight: 325.82
EC Number: 208-591-9
MDL Number: MFCD00010957
Linear Formula: Cs2CO3
Product Type: Chemical
| anion traces | chloride (Cl-): ≤1000 mg/kg |
| sulfate (SO42-): ≤500 mg/kg | |
| assay | ≥98.0% (T) |
| cation traces | Ca: ≤50 mg/kg |
| Cd: ≤50 mg/kg | |
| Co: ≤50 mg/kg | |
| Cu: ≤50 mg/kg | |
| Fe: ≤50 mg/kg | |
| K: ≤200 mg/kg | |
| Na: ≤250 mg/kg | |
| Ni: ≤50 mg/kg | |
| Pb: ≤50 mg/kg | |
| Zn: ≤50 mg/kg | |
| grade | purum p.a. |
| InChI | 1S/CH2O3.2Cs/c2-1(3)4;;/h |
| InChI key | FJDQFPXHSGXQBY-UHFFFAOYSA |
| loss | ≤2% loss on drying |
| mp | 610 °C (dec.) (lit.) |
| Quality Level | 100  |
| SMILES string | [Cs+].[Cs+].[O-]C([O-])=O |
| Application: | Catalyst for: aerobic oxidation of primary alcohols 1,4-addition reactions Reagent for: Synthesis of phosphazene derivatives Constrictive binding interactions Intramolecular C-N cross coupling reactions Dehydrohalogenative polycondensation |
| Application: | Promotes the efficient O-alkylation of alcohols to form mixed alkyl carbonates. |
| Other Notes: | Used for preparing cesium carboxylates which react with halogenides to give esters and lactones ; Used for an analogous preparation of thio ethers |
| Symbol |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H318 - H361f - H373 |
| Precautionary statements | P201 - P202 - P260 - P280 - P305 + P351 + P338 - P308 + P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (T) |
| mp | 610 °C (dec.) (lit.) |
| UNSPSC | 12352301 |