Disperse Blue 1
SIAL/215643 - Dye content 30 %
Synonym: 1,4,5,8-
CAS Number: 2475-45-8
Empirical Formula (Hill Notation): C14H12N4O2
Molecular Weight: 268.27
EC Number: 219-603-7
MDL Number: MFCD00001225
Linear Formula: C14H12N4O2
Product Type: Chemical
| λmax | 607 nm |
| application(s) | diagnostic assay manufacturing hematology histology |
| composition | Dye content, 30% |
| form | powder |
| InChI | 1S/C14H12N4O2/c15-5-1-2-6 |
| InChI key | JSFUMBWFPQSADC-UHFFFAOYSA |
| mp | 332 °C |
| SMILES string | Nc1ccc(N)c2C(=O)c3c(N)ccc |
| solubility | 1 M NH4OH: 10 mg/mL, opaque, blue |
| storage temp. | room temp |
| General description: | Disperse Blue 1 is a grey to black powder. Disperse dyes are known to be insoluble in water and are applied to the substrate as suspensions or dispersions by dissolving in hydrophobic regions of the polymers making up the fiber. |
| Packaging: | 5 g in glass bottle |
| Symbol | ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315 - H317 - H318 - H350 |
| Precautionary statements | P201 - P280 - P302 + P352 - P305 + P351 + P338 + P310 - P308 + P313 |
| Hazard Codes | T |
| Risk Statements | 45-38-41-43 |
| Safety Statements | 53-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 332 °C |
| Storage Temp. | room temp |
| Colour Index Number | 64500 |
| UNSPSC | 12171500 |



