(+)-Carvone
SIAL/22070 - analytical standard
Synonym: (+)-p-Mentha-6,8-diene 2-one; (S)
CAS Number: 2244-16-8
Empirical Formula (Hill Notation): C10H14O
Molecular Weight: 150.22
EC Number: 218-827-2
MDL Number: MFCD00062997
Linear Formula: C10H14O
Product Type: Chemical
| application(s) | agriculture environmental food and beverages |
| assay | ≥98.5% (sum of enantiomers, GC) |
| bp | 228-230 °C (lit.) |
| density | 0.960 g/mL at 20 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C10H14O/c1-7(2)9-5-4-8 |
| InChI key | ULDHMXUKGWMISQ-VIFPVBQESA |
| optical activity | [α]20/D +61±2°, neat |
| Quality Level | 100  |
| refractive index | n |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(=C)[C@H]1CC=C(C)C(=O)C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | (+)-Carvone (S-carvone), is a monoterpene which has the ability to affect regulation of plant growth and development and microbial activity, it can also prevent sprouting in potato, through inhibition of the induction of phenylalanine ammonia-lyase (PAL) activity, thereby blocking suberisation. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261 - P272 - P280 - P302 + P352 - P333 + P313 - P362 + P364 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 204.1 °F - closed cup |
| Flash Point(C) | 95.6 °C - closed cup |
| Purity | ≥98.5% (sum of enantiomers, GC) |
| bp | 228-230 °C (lit.) |
| Density | 0.960 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 85151701 |