Synonym: Cellobiose, Cellose, Beta-Cellobiose, D-Cellobiose; β-D-Glc-(1→4)-D-Glc; 4-O-β-D-Glucopyranosyl-D-glucose
CAS Number: 528-50-7
Empirical Formula (Hill Notation): C12H22O11
Molecular Weight: 342.30
EC Number: 208-436-5
MDL Number: MFCD00136034
Linear Formula: C12H22O11
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 22150-250G
| anion traces |
chloride (Cl-): ≤50 mg/kg |
| |
sulfate (SO42-): ≤50 mg/kg |
| application(s) |
microbiology |
| assay |
≥99.0% |
| |
≥99.0% (HPLC) |
| cation traces |
As: ≤0.1 mg/kg |
| |
Ca: ≤10 mg/kg |
| |
Cd: ≤5 mg/kg |
| |
Co: ≤5 mg/kg |
| |
Cr: ≤5 mg/kg |
| |
Cu: ≤5 mg/kg |
| |
Fe: ≤5 mg/kg |
| |
K: ≤150 mg/kg |
| |
Mg: ≤5 mg/kg |
| |
Mn: ≤5 mg/kg |
| |
Na: ≤50 mg/kg |
| |
Ni: ≤5 mg/kg |
| |
Pb: ≤5 mg/kg |
| |
Zn: ≤5 mg/kg |
| form |
powder |
| ign. residue |
≤0.1% (as SO4) |
| InChI |
1S/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h1,4-12,14-21H,2-3H2/t4-,5+,6+,7+,8+,9-,10+,11+,12-/m0/s1 |
| InChI key |
DKXNBNKWCZZMJT-WELRSGGNSA-N |
| loss |
≤1% loss on drying, 110 °C |
| mol wt |
342.30 g/mol |
| mp |
239 °C (dec.) (lit.) |
| |
~235 °C (dec.) |
| optical activity |
[α]20/D +34±1°, 15 hr, c = 10% in H2O |
| Quality Level |
200  |
| SMILES string |
OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)C=O |
| Application: |
Cellobiose has applications as a carbohydrate source in culture media and biochemical characterization of microorganisms, based on their carbohydrate fermentation abilities |
| General description: |
Cellobiose is a disaccharide that is a reducing sugar. It is added to culture media as a nutrient supplement, specifically as a carbohydrate source, and can be used to differentiate bacteria based on their ability to ferment cellobiose. For example, Vibrio spp. can ferment cellobiose which results in acid production and can be indicated by the pH indicator bromothymol blue, which turns yellow at acidic pH. The addition of cellobiose in the media also stimulates the initial growth of Salmonella. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99.0% (HPLC); ≥99.0% |
| mp |
~235 °C (dec.); 239 °C (dec.) (lit.) |
| UNSPSC |
41106212 |