Cellulose
SIAL/22182 - acid washed, from spruce, suitable for column chromatography
Synonym: Cellulose powder; Cotton linters
CAS Number: 9004-34-6
EC Number: 232-674-9
MDL Number: MFCD00081512
Product Type: Chemical
| biological source | spruce |
| cation traces | Cu: ≤5 mg/kg |
| Fe: ≤10 mg/kg | |
| fiber L | 0.02-0.15 mm |
| form | powder |
| ign. residue | ~0.01% |
| impurities | ≤0.05% ether extract |
| InChI | 1S/C12H22O11/c13-1-3-5(15 |
| InChI key | GUBGYTABKSRVRQ-WFVLMXAXSA |
| matrix | Cellulose |
| matrix active group | polymer |
| particle size | 20-150 μm |
| quality | acid washed |
| Quality Level | 100 ![]() |
| separation technique | size exclusion (SEC) |
| SMILES string | O1[C@H](C(C(C(C1CO)O)O)O) |
| suitability | suitable for column chromatography |
| technique(s) | LPLC: suitable |
| Application: | Cellulose was used to measure the cyrstallinity index using X-ray diffraction (XRD) patterns and solid-state 13C nuclear magnetic resonance spectra. |
| Application: | High purity cellulose powders for partition chromatography. |
| General description: | Cellulose, a homopolymer consisting of glucose units joined by beta-1,4 bonds. These are strongly attached through inter and intramolecular hydrogen bonds and van der Waals forces resulting in microfibrils which together form fibers. They are arranged in parallel reducing ends of adjacent glucan chains. Cellulose is widely used as sorbent in TLC. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 23151817 |

