Cellulose
SIAL/22197 - DS-0, powder, suitable for thin layer chromatography (TLC)
Synonym: Cellulose powder; Cotton linters
CAS Number: 9004-34-6
EC Number: 232-674-9
MDL Number: MFCD00081512
Product Type: Chemical
| form | powder |
| ign. residue | ≤0.1% |
| InChI | 1S/C12H22O11/c13-1-3-5(15 |
| InChI key | GUBGYTABKSRVRQ-WFVLMXAXSA |
| loss | ≤5% loss on drying |
| Quality Level | 100 ![]() |
| SMILES string | O1[C@H](C(C(C(C1CO)O)O)O) |
| technique(s) | thin layer chromatography (TLC): suitable |
| Application: | Cellulose was used to measure the cyrstallinity index using X-ray diffraction (XRD) patterns and solid-state 13C nuclear magnetic resonance (NMR) spectra. |
| Application: | High purity cellulose powders for partition chromatography. |
| Application: | microcrystalline cellulose for all types of separation chromatography and thin layer electrophoresis |
| General description: | Cellulose, a homopolymer consisting of glucose units joined by β-1,4 bonds. These are strongly attached through inter and intramolecular hydrogen bonds and vander Waals forces resulting in microfibrils which together form fibers. They are arranged in parallel reducing ends of adjacent glucan chains. Cellulose is widely used as sorbent in TLC. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 41115711 |

