Ammonium citrate dibasic
SIAL/247561 - ACS reagent, 98%
Synonym: Ammonium hydrogencitrate; Citric acid ammonium salt; Diammonium hydrogen citrate
CAS Number: 3012-65-5
Empirical Formula (Hill Notation): C6H14N2O7
Molecular Weight: 226.18
EC Number: 221-146-3
MDL Number: MFCD00013068
Linear Formula: HOC(CO2H)(CH2CO2NH4)2
Product Type: Chemical
| anion traces | chloride (Cl-): ≤0.001% |
| phosphate (PO43-): ≤5 ppm | |
| sulfate (SO42-): ≤0.005% | |
| assay | 98% |
| 98.0-103.0% (ACS specification) | |
| cation traces | Fe: ≤0.001% |
| heavy metals: ≤5 ppm (by ICP) | |
| form | solid |
| functional group | carboxylic acid |
| hydroxyl | |
| grade | ACS reagent |
| ign. residue | ≤0.01% |
| impurities | oxalate, passes test (lim ~0.05%) |
| ≤0.005% insolubles | |
| InChI | 1S/C6H8O7.2H3N/c7-3(8)1-6 |
| InChI key | YXVFQADLFFNVDS-UHFFFAOYSA |
| pH | 5.2 (20 °C, 50 g/L) |
| Quality Level | 200 ![]() |
| SMILES string | N.N.OC(=O)CC(O)(CC(O)=O)C |
| vapor density | 1.8 (vs air) |
| Application: | Ammonium citrate dibasic can be used as both carbon and nitrogen precursor to synthesize nitrogen-doped fluorescent carbon nanoparticles (CNPs) for the development of sensitive and selective sensors for picric acid detection. Solution form of ammonium citrate can also be used in leaching experiments to extract copper nanoparticles from waste printed circuit boards (WPCBs). |
| Packaging: | 100, 500 g in poly bottle |
| Packaging: | 2.5 kg in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98%; 98.0-103.0% (ACS specification) |
| UNSPSC | 12352100 |


