Synonym: Dexamethasonum; (11β,16α)-9-Fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione; 9α-Fluoro-16α-methyl-11β,17α,21-trihydroxy-1,4-pregnadiene-3,20-dione; 9α-Fluoro-16α-methylprednisolone; Prednisolone F
CAS Number: 50-02-2
Empirical Formula (Hill Notation): C22H29FO5
Molecular Weight: 392.46
EC Number: 200-003-9
MDL Number: MFCD00064136
Linear Formula: C22H29FO5
Product Type: Chemical
| agency |
tested according to Ph. Eur. |
| |
USP/NF |
| application(s) |
pharmaceutical (small molecule) |
| assay |
99.6% |
| form |
solid |
| InChI |
1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1 |
| InChI key |
UREBDLICKHMUKA-CXSFZGCWSA-N |
| mp |
262-264 °C (lit.) |
| Quality Level |
100  |
| SMILES string |
C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO |
| solubility |
acetone: very slightly soluble |
| |
alcohol: very slightly soluble |
| |
chloroform: slightly soluble |
| |
diethyl ether: very slightly soluble |
| |
dioxane: very slightly soluble |
| |
methanol: very slightly soluble |
| |
water: soluble 10mg/100 ml at 25 °C |
| Application: |
Dexamethasone has been used as a DMEM medium supplement utilized in osteogenesis. It has also been used as an alpha-MEM medium supplement to initiate adipogenic differentiation. Additionally, it has also been used to study apoptosis, cell signaling pathways and gene expression. |
| Biochem/physiol Actions: |
Dexamethasone is a glucocorticoid anti-inflammatory agent. It regulates T cell survival, growth, and differentiation. Additionally, dexamethasone inhibits the induction of nitric oxide synthase. It induces apoptosis by initiating the initial cleavage of DNA into high molecular weight fragments. |
| Biochem/physiol Actions: |
Glucocorticoid anti-inflammatory agent |
| Biochem/physiol Actions: |
Glucocorticoid anti-inflammatory agent. Regulates T cell survival, growth, and differentiation. Inhibits the induction of nitric oxide synthase. |
| Purity |
99.6% |
| mp |
262-264 °C (lit.) |
| UNSPSC |
41116107 |