Metalaxyl
SIAL/32012 - PESTANAL®, analytical standard
Synonym: N-
CAS Number: 57837-19-1
Empirical Formula (Hill Notation): C15H21NO4
Molecular Weight: 279.33
EC Number: 260-979-7
MDL Number: MFCD00055447
Linear Formula: C15H21NO4
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C15H21NO4/c1-10-7-6-8- |
| InChI key | ZQEIXNIJLIKNTD-UHFFFAOYSA |
| mp | 69-73 °C |
| product line | PESTANAL® |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | COCC(=O)N(C(C)C(=O)OC)c1c |
| suitability | passes test for identity (NMR) |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable | |
| NMR: suitable |
| Application: | Metalaxyl has been used as reference standard in Fourier transform infrared (FTIR) spectrometric method for determination of metalaxyl in pesticide formulations. |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Metalaxyl, also known as Ridomil, is a phenylamide and systemic benzoic fungicide. It is generally used to control infection caused by Phytophthora infestans. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H317 - H412 |
| Precautionary statements | P261 - P264 - P273 - P280 - P301 + P312 - P302 + P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-43-52/53 |
| Safety Statements | 13-24-37-46-61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 212.0 °F - closed cup |
| Flash Point(C) | 100 °C - closed cup |
| mp | 69-73 °C |
| UNSPSC | 41116107 |