Fenbendazole-d3
SIAL/32567 - VETRANAL®, analytical standard
Synonym: Methyl-d3 5-
CAS Number: 1228182-47-5
Empirical Formula (Hill Notation): C15D3H10N3O2S
Molecular Weight: 302.37
MDL Number: MFCD16652570
Linear Formula: C15D3H10N3O2S
Product Type: Chemical
| application(s) | clinical testing |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C15H13N3O2S/c1-20-15(1 |
| InChI key | HDDSHPAODJUKPD-FIBGUPNXSA |
| mass shift | M+3 |
| product line | VETRANAL® |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | [2H]C([2H])([2H])OC(=O)Nc |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Chemical structure: benzimidazole |
| Legal Information: | VETRANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H361fd - H373 - H410 |
| Precautionary statements | P201 - P202 - P260 - P273 - P280 - P308 + P313 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| UNSPSC | 41116107 |



