Methiocarb sulfoxide
SIAL/34177 - PESTANAL®, analytical standard
Synonym: 4-
CAS Number: 2635-10-1
Empirical Formula (Hill Notation): C11H15NO3S
Molecular Weight: 241.31
MDL Number: MFCD00155393
Linear Formula: C11H15NO3S
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C11H15NO3S/c1-7-5-9(15 |
| InChI key | FNCMBMZOZQAWJA-UHFFFAOYSA |
| product line | PESTANAL® |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CNC(=O)Oc1cc(C)c(c(C)c1)S |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Methiocarb sulfoxide, is a carbamate insecticide, which is used to control rice insects. It is a metabolite of methiocarb present in honey. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300 - H400 |
| Precautionary statements | P273 - P301 + P310 + P330 |
| Hazard Codes | T,N |
| Risk Statements | 25-50/53 |
| Safety Statements | 45-60-61 |
| RIDADR | UN2811 - class 6.1 - PG 2 - EHS - Toxic solids, organic, n.o.s., |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | 2-8°C |
| UNSPSC | 41116107 |