Flutriafol
SIAL/34344 - PESTANAL®, analytical standard
CAS Number: 76674-21-0
Empirical Formula (Hill Notation): C16H13F2N3O
Molecular Weight: 301.29
MDL Number: MFCD00144319
Linear Formula: C16H13F2N3O
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C16H13F2N3O/c17-13-7-5 |
| InChI key | JWUCHKBSVLQQCO-UHFFFAOYSA |
| product line | PESTANAL® |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | OC(Cn1cncn1)(c2ccc(F)cc2) |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Flutriafol may be used as a reference standard in the determination of flutriafol in food and environmental matrices by reversed-phase high-performance liquid chromatography. |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Flutriafol is a sterol-inhibiting triazole fungicide. Its mode of action is through the inhibition of C-14α-demethylase enzyme involved in fungal sterol biosynthesis. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301 + P312 + P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 41116107 |