Cyprodinil
SIAL/34389 - PESTANAL®, analytical standard
Synonym: 4-
CAS Number: 121552-61-2
Empirical Formula (Hill Notation): C14H15N3
Molecular Weight: 225.29
MDL Number: MFCD01632330
Linear Formula: C14H15N3
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C14H15N3/c1-10-9-13(11 |
| InChI key | HAORKNGNJCEJBX-UHFFFAOYSA |
| product line | PESTANAL® |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | Cc1cc(nc(Nc2ccccc2)n1)C3C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317 - H410 |
| Precautionary statements | P261 - P272 - P273 - P280 - P302 + P352 - P333 + P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38-43 |
| Safety Statements | 26-36 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 41116107 |


