Linuron-(methyl-d3, methoxy-d3)
SIAL/34523 - PESTANAL®, analytical standard
Synonym: 3-
CAS Number: 1219804-76-8
Empirical Formula (Hill Notation): C9D6H4Cl2N2O2
Molecular Weight: 255.13
MDL Number: MFCD04972576
Linear Formula: C9D6H4Cl2N2O2
Product Type: Chemical
| application(s) | agriculture environmental |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C9H10Cl2N2O2/c1-13(15- |
| InChI key | XKJMBINCVNINCA-WFGJKAKNSA |
| product line | PESTANAL® |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | O=C(NC1=CC(Cl)=C(Cl)C=C1) |
| Legal Information: | PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol | ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302 - H351 - H360 - H373 - H410 |
| Precautionary statements | P201 - P202 - P260 - P273 - P301 + P312 - P308 + P313 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 77101502 |




